C21H31N3 — CID 746848
N,N-diethyl-2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanamine (PubChem CID 746848) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is N,N-diethyl-2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanamine |
|---|---|
| PubChem CID | 746848 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N,N-diethyl-2-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]ethanamine |
| SMILES | CCN(CC)CCN1CCn2c3c(c4cc(C)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C21H31N3/c1-4-22(5-2)11-12-23-13-14-24-19-10-9-16(3)15-18(19)17-7-6-8-20(23)21(17)24/h9-10,15,20H,4-8,11-14H2,1-3H3/t20-/m0/s1 |
| InChIKey | DLIMQMFEKLIBNI-FQEVSTJZSA-N |
| XLogP | 3.98 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|