C24H38N4O — CID 6360873
(2S)-1-[2-(diethylamino)ethylamino]-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol (PubChem CID 6360873) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is (2S)-1-[2-(diethylamino)ethylamino]-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(diethylamino)ethylamino]-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 6360873 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | (2S)-1-[2-(diethylamino)ethylamino]-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol |
| SMILES | CCN(CC)CCNC[C@H](O)CN1CCn2c3c(c4cc(C)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C24H38N4O/c1-4-26(5-2)12-11-25-16-19(29)17-27-13-14-28-22-10-9-18(3)15-21(22)20-7-6-8-23(27)24(20)28/h9-10,15,19,23,25,29H,4-8,11-14,16-17H2,1-3H3/t19-,23-/m0/s1 |
| InChIKey | WIWRJIZZYKIADD-CVDCTZTESA-N |
| XLogP | 2.94 |
| TPSA | 43.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|