C24H36N4O — CID 11899789
(2S)-1-(4-ethylpiperazin-1-yl)-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol (PubChem CID 11899789) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is (2S)-1-(4-ethylpiperazin-1-yl)-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol.
| Compound Name | (2S)-1-(4-ethylpiperazin-1-yl)-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 11899789 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | (2S)-1-(4-ethylpiperazin-1-yl)-3-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propan-2-ol |
| SMILES | CCN1CCN(C[C@H](O)CN2CCn3c4c(c5cc(C)ccc53)CCC[C@@H]42)CC1 |
| InChI | InChI=1S/C24H36N4O/c1-3-25-9-11-26(12-10-25)16-19(29)17-27-13-14-28-22-8-7-18(2)15-21(22)20-5-4-6-23(27)24(20)28/h7-8,15,19,23,29H,3-6,9-14,16-17H2,1-2H3/t19-,23-/m0/s1 |
| InChIKey | HFDBNPIDCZKBSN-CVDCTZTESA-N |
| XLogP | 2.64 |
| TPSA | 34.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|