C24H28N2O — CID 7011186
(2S)-1-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-3-phenylpropan-2-ol (PubChem CID 7011186) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is (2S)-1-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-3-phenylpropan-2-ol.
| Compound Name | (2S)-1-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 7011186 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (2S)-1-[(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]-3-phenylpropan-2-ol |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN(C[C@@H](O)Cc2ccccc2)[C@H]3CCC1 |
| InChI | InChI=1S/C24H28N2O/c1-17-10-11-22-21(14-17)20-8-5-9-23-24(20)26(22)13-12-25(23)16-19(27)15-18-6-3-2-4-7-18/h2-4,6-7,10-11,14,19,23,27H,5,8-9,12-13,15-16H2,1H3/t19-,23-/m0/s1 |
| InChIKey | QKXYCJQGQLIAOP-CVDCTZTESA-N |
| XLogP | 4.25 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|