C23H26N2 — CID 25423280
(5S)-12-methyl-4-[(1R)-1-phenylethyl]-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene (PubChem CID 25423280) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (5S)-12-methyl-4-[(1R)-1-phenylethyl]-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene.
| Compound Name | (5S)-12-methyl-4-[(1R)-1-phenylethyl]-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
|---|---|
| PubChem CID | 25423280 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (5S)-12-methyl-4-[(1R)-1-phenylethyl]-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene |
| SMILES | Cc1ccc2c(c1)c1c3n2CCN([C@H](C)c2ccccc2)[C@H]3CCC1 |
| InChI | InChI=1S/C23H26N2/c1-16-11-12-21-20(15-16)19-9-6-10-22-23(19)25(21)14-13-24(22)17(2)18-7-4-3-5-8-18/h3-5,7-8,11-12,15,17,22H,6,9-10,13-14H2,1-2H3/t17-,22+/m1/s1 |
| InChIKey | GNVBGFAKJVJGJT-VGSWGCGISA-N |
| XLogP | 5.40 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|