C18H22ClNO2 — CID 84612169
ethyl 6-chloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylate (PubChem CID 84612169) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is ethyl 6-chloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylate.
| Compound Name | ethyl 6-chloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 84612169 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | ethyl 6-chloro-9-propyl-1,2,3,4-tetrahydrocarbazole-3-carboxylate |
| SMILES | CCCn1c2c(c3cc(Cl)ccc31)CC(C(=O)OCC)CC2 |
| InChI | InChI=1S/C18H22ClNO2/c1-3-9-20-16-7-5-12(18(21)22-4-2)10-14(16)15-11-13(19)6-8-17(15)20/h6,8,11-12H,3-5,7,9-10H2,1-2H3 |
| InChIKey | PKBDVGHSJMRWRZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|