C15H15ClO3 — CID 54530969
ethyl 7-chloro-1,2,3,4-tetrahydrodibenzofuran-3-carboxylate (PubChem CID 54530969) has the molecular formula C15H15ClO3 and a molecular weight of 278.74 g/mol. Its IUPAC name is ethyl 7-chloro-1,2,3,4-tetrahydrodibenzofuran-3-carboxylate.
| Compound Name | ethyl 7-chloro-1,2,3,4-tetrahydrodibenzofuran-3-carboxylate |
|---|---|
| PubChem CID | 54530969 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethyl 7-chloro-1,2,3,4-tetrahydrodibenzofuran-3-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(oc3cc(Cl)ccc23)C1 |
| InChI | InChI=1S/C15H15ClO3/c1-2-18-15(17)9-3-5-11-12-6-4-10(16)8-14(12)19-13(11)7-9/h4,6,8-9H,2-3,5,7H2,1H3 |
| InChIKey | YWMXRONQCWEFNN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |