C18H19NO3S — CID 18182175
ethyl 2-amino-3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate (PubChem CID 18182175) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is ethyl 2-amino-3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate.
| Compound Name | ethyl 2-amino-3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate |
|---|---|
| PubChem CID | 18182175 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | ethyl 2-amino-3-benzoyl-4,5,6,7-tetrahydro-1-benzothiophene-6-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(sc(N)c2C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO3S/c1-2-22-18(21)12-8-9-13-14(10-12)23-17(19)15(13)16(20)11-6-4-3-5-7-11/h3-7,12H,2,8-10,19H2,1H3 |
| InChIKey | JCJOWIIKHWZRLE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|