C20H20ClN2O2S2+ — CID 19438698
ethyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3,7,8,9,10-hexahydro-[1]benzothiolo[3,2-d]diazepin-2-ium-8-carboxylate (PubChem CID 19438698) has the molecular formula C20H20ClN2O2S2+ and a molecular weight of 419.98 g/mol. Its IUPAC name is ethyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3,7,8,9,10-hexahydro-[1]benzothiolo[3,2-d]diazepin-2-ium-8-carboxylate.
| Compound Name | ethyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3,7,8,9,10-hexahydro-[1]benzothiolo[3,2-d]diazepin-2-ium-8-carboxylate |
|---|---|
| PubChem CID | 19438698 |
| Molecular Formula | C20H20ClN2O2S2+ |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | ethyl 5-(2-chlorophenyl)-2-sulfanylidene-1,3,7,8,9,10-hexahydro-[1]benzothiolo[3,2-d]diazepin-2-ium-8-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(sc3c2C[N+](=S)NC=C3c2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H20ClN2O2S2/c1-2-25-20(24)12-7-8-14-16-11-23(26)22-10-15(19(16)27-18(14)9-12)13-5-3-4-6-17(13)21/h3-6,10,12H,2,7-9,11H2,1H3,(H,22,26)/q+1 |
| InChIKey | DJSJOIDUYRWYRF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|