About ethyl 4-oxocyclohexane-1-carboxylate;toluene
ethyl 4-oxocyclohexane-1-carboxylate;toluene (PubChem CID 174392547) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl 4-oxocyclohexane-1-carboxylate;toluene.
Molecular Properties
| Compound Name | ethyl 4-oxocyclohexane-1-carboxylate;toluene |
| PubChem CID | 174392547 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl 4-oxocyclohexane-1-carboxylate;toluene |
| SMILES | CCOC(=O)C1CCC(=O)CC1.Cc1ccccc1 |
| InChI | InChI=1S/C9H14O3.C7H8/c1-2-12-9(11)7-3-5-8(10)6-4-7;1-7-5-3-2-4-6-7/h7H,2-6H2,1H3;2-6H,1H3 |
| InChIKey | KGHJPKXTUXHGNY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-oxocyclohexane-1-carboxylate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxocyclohexane-1-carboxylate;toluene?
The IUPAC name of ethyl 4-oxocyclohexane-1-carboxylate;toluene (CID 174392547) is ethyl 4-oxocyclohexane-1-carboxylate;toluene.
What is the SMILES notation for ethyl 4-oxocyclohexane-1-carboxylate;toluene?
The canonical SMILES for ethyl 4-oxocyclohexane-1-carboxylate;toluene is CCOC(=O)C1CCC(=O)CC1.Cc1ccccc1.
What is the InChIKey of ethyl 4-oxocyclohexane-1-carboxylate;toluene?
The InChIKey is KGHJPKXTUXHGNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3.C7H8/c1-2-12-9(11)7-3-5-8(10)6-4-7;1-7-5-3-2-4-6-7/h7H,2-6H2,1H3;2-6H,1H3.
What are the key properties of ethyl 4-oxocyclohexane-1-carboxylate;toluene?
ethyl 4-oxocyclohexane-1-carboxylate;toluene has a molecular weight of 262.35 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxocyclohexane-1-carboxylate;toluene is sourced from PubChem (CID 174392547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).