C19H22FNOS — CID 4868422
(2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-fluorophenyl)methanone (PubChem CID 4868422) has the molecular formula C19H22FNOS and a molecular weight of 331.46 g/mol. Its IUPAC name is (2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-fluorophenyl)methanone.
| Compound Name | (2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 4868422 |
| Molecular Formula | C19H22FNOS |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(3-fluorophenyl)methanone |
| SMILES | CC(C)(C)C1CCc2c(sc(N)c2C(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H22FNOS/c1-19(2,3)12-7-8-14-15(10-12)23-18(21)16(14)17(22)11-5-4-6-13(20)9-11/h4-6,9,12H,7-8,10,21H2,1-3H3 |
| InChIKey | QMNUABQTEYKEST-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|