C14H12FNOS — CID 11129084
(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(3-fluorophenyl)methanone (PubChem CID 11129084) has the molecular formula C14H12FNOS and a molecular weight of 261.32 g/mol. Its IUPAC name is (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(3-fluorophenyl)methanone.
| Compound Name | (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 11129084 |
| Molecular Formula | C14H12FNOS |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)-(3-fluorophenyl)methanone |
| SMILES | Nc1sc2c(c1C(=O)c1cccc(F)c1)CCC2 |
| InChI | InChI=1S/C14H12FNOS/c15-9-4-1-3-8(7-9)13(17)12-10-5-2-6-11(10)18-14(12)16/h1,3-4,7H,2,5-6,16H2 |
| InChIKey | IKCROCHLDCUTIP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|