C9H11NOS — CID 65354676
1-(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)ethanone (PubChem CID 65354676) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 1-(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)ethanone.
| Compound Name | 1-(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 65354676 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 1-(2-amino-5,6-dihydro-4H-cyclopenta[b]thiophen-3-yl)ethanone |
| SMILES | CC(=O)c1c(N)sc2c1CCC2 |
| InChI | InChI=1S/C9H11NOS/c1-5(11)8-6-3-2-4-7(6)12-9(8)10/h2-4,10H2,1H3 |
| InChIKey | BWVFRMWWDMKVNA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|