C9H11NO2S — CID 65354828
1-(2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-yl)ethanone (PubChem CID 65354828) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 1-(2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-yl)ethanone.
| Compound Name | 1-(2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-yl)ethanone |
|---|---|
| PubChem CID | 65354828 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1-(2-amino-5,7-dihydro-4H-thieno[2,3-c]pyran-3-yl)ethanone |
| SMILES | CC(=O)c1c(N)sc2c1CCOC2 |
| InChI | InChI=1S/C9H11NO2S/c1-5(11)8-6-2-3-12-4-7(6)13-9(8)10/h2-4,10H2,1H3 |
| InChIKey | JVJZOUPHTGANMQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|