C10H7NO5S — CID 101372177
2-(2,3-dioxoaziridin-1-yl)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid (PubChem CID 101372177) has the molecular formula C10H7NO5S and a molecular weight of 253.23 g/mol. Its IUPAC name is 2-(2,3-dioxoaziridin-1-yl)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid.
| Compound Name | 2-(2,3-dioxoaziridin-1-yl)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid |
|---|---|
| PubChem CID | 101372177 |
| Molecular Formula | C10H7NO5S |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-(2,3-dioxoaziridin-1-yl)-5,7-dihydro-4H-thieno[2,3-c]pyran-3-carboxylic acid |
| SMILES | O=C(O)c1c(-n2c(=O)c2=O)sc2c1CCOC2 |
| InChI | InChI=1S/C10H7NO5S/c12-7-8(13)11(7)9-6(10(14)15)4-1-2-16-3-5(4)17-9/h1-3H2,(H,14,15) |
| InChIKey | GUHPDBCMHVIKGG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|