About 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid
5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid (PubChem CID 82406699) has the molecular formula C8H8O3S
and a molecular weight of 184.22 g/mol. Its IUPAC name is 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid.
Molecular Properties
| Compound Name | 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid |
| PubChem CID | 82406699 |
| Molecular Formula | C8H8O3S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)COCC2 |
| InChI | InChI=1S/C8H8O3S/c9-8(10)6-3-5-1-2-11-4-7(5)12-6/h3H,1-2,4H2,(H,9,10) |
| InChIKey | ATQZJQVZQHPLOO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid?
The IUPAC name of 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid (CID 82406699) is 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid.
What is the SMILES notation for 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid?
The canonical SMILES for 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid is O=C(O)c1cc2c(s1)COCC2.
What is the InChIKey of 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid?
The InChIKey is ATQZJQVZQHPLOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S/c9-8(10)6-3-5-1-2-11-4-7(5)12-6/h3H,1-2,4H2,(H,9,10).
What are the key properties of 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid?
5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid has a molecular weight of 184.22 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-4H-thieno[2,3-c]pyran-2-carboxylic acid is sourced from PubChem (CID 82406699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).