About 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid
5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid (PubChem CID 82397438) has the molecular formula C8H8O2S2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid.
Analyze 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid?
The IUPAC name of 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid (CID 82397438) is 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid.
What is the SMILES notation for 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid?
The canonical SMILES for 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid is O=C(O)c1cc2c(s1)CSCC2.
What is the InChIKey of 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid?
The InChIKey is FIYBUOIFRVLKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S2/c9-8(10)6-3-5-1-2-11-4-7(5)12-6/h3H,1-2,4H2,(H,9,10).
What are the key properties of 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid?
5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid has a molecular weight of 200.28 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-4H-thieno[2,3-c]thiopyran-2-carboxylic acid is sourced from PubChem (CID 82397438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).