C16H15NO3S — CID 139994449
benzoyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 139994449) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is benzoyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | benzoyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 139994449 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | benzoyl 2-amino-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | Nc1sc2c(c1C(=O)OC(=O)c1ccccc1)CCCC2 |
| InChI | InChI=1S/C16H15NO3S/c17-14-13(11-8-4-5-9-12(11)21-14)16(19)20-15(18)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9,17H2 |
| InChIKey | WKPZXQRMKXGYMQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|