C18H18N2OS — CID 66603492
(2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(2-methyl-1H-indol-3-yl)methanone (PubChem CID 66603492) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(2-methyl-1H-indol-3-yl)methanone.
| Compound Name | (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(2-methyl-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 66603492 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2-amino-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-(2-methyl-1H-indol-3-yl)methanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)c1c(N)sc2c1CCCC2 |
| InChI | InChI=1S/C18H18N2OS/c1-10-15(11-6-2-4-8-13(11)20-10)17(21)16-12-7-3-5-9-14(12)22-18(16)19/h2,4,6,8,20H,3,5,7,9,19H2,1H3 |
| InChIKey | AMDLQLKVGOTBCF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|