C16H19N3OS — CID 54587438
2-amino-N'-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbohydrazide (PubChem CID 54587438) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-amino-N'-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbohydrazide.
| Compound Name | 2-amino-N'-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 54587438 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-amino-N'-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carbohydrazide |
| SMILES | Nc1sc2c(c1C(=O)NNc1ccccc1)CCCCC2 |
| InChI | InChI=1S/C16H19N3OS/c17-15-14(12-9-5-2-6-10-13(12)21-15)16(20)19-18-11-7-3-1-4-8-11/h1,3-4,7-8,18H,2,5-6,9-10,17H2,(H,19,20) |
| InChIKey | FARKWONVOBFXJP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|