C24H26N4O4S2 — CID 45112458
1-(benzenesulfonyl)-3-[3-[(4-methylanilino)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]urea (PubChem CID 45112458) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[3-[(4-methylanilino)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]urea.
| Compound Name | 1-(benzenesulfonyl)-3-[3-[(4-methylanilino)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]urea |
|---|---|
| PubChem CID | 45112458 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[3-[(4-methylanilino)carbamoyl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]urea |
| SMILES | Cc1ccc(NNC(=O)c2c(NC(=O)NS(=O)(=O)c3ccccc3)sc3c2CCCCC3)cc1 |
| InChI | InChI=1S/C24H26N4O4S2/c1-16-12-14-17(15-13-16)26-27-22(29)21-19-10-6-3-7-11-20(19)33-23(21)25-24(30)28-34(31,32)18-8-4-2-5-9-18/h2,4-5,8-9,12-15,26H,3,6-7,10-11H2,1H3,(H,27,29)(H2,25,28,30) |
| InChIKey | VQOLVOZLJVUQAK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|