C18H20N2O4S2 — CID 23827579
2-[(4-methylphenyl)sulfonylcarbonylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 23827579) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylcarbonylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylcarbonylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 23827579 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylcarbonylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)C(=O)Nc2sc3c(c2C(N)=O)CCCCC3)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-11-7-9-12(10-8-11)26(23,24)18(22)20-17-15(16(19)21)13-5-3-2-4-6-14(13)25-17/h7-10H,2-6H2,1H3,(H2,19,21)(H,20,22) |
| InChIKey | AQTLVHIFFFDKTI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|