C18H22N2O3S2 — CID 1220084
2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 1220084) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 1220084 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2sc3c(c2C(N)=O)CCCCCC3)cc1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-12-8-10-13(11-9-12)25(22,23)20-18-16(17(19)21)14-6-4-2-3-5-7-15(14)24-18/h8-11,20H,2-7H2,1H3,(H2,19,21) |
| InChIKey | HJBKZQDOUPLIBK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'} |
|---|