C14H13N3O5S2 — CID 19203747
2-[(3-nitrophenyl)sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 19203747) has the molecular formula C14H13N3O5S2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(3-nitrophenyl)sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 19203747 |
| Molecular Formula | C14H13N3O5S2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 2-[(3-nitrophenyl)sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)sc2c1CCC2 |
| InChI | InChI=1S/C14H13N3O5S2/c15-13(18)12-10-5-2-6-11(10)23-14(12)16-24(21,22)9-4-1-3-8(7-9)17(19)20/h1,3-4,7,16H,2,5-6H2,(H2,15,18) |
| InChIKey | RVMZSJRFCNBGHK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|