C16H17FN2O3S2 — CID 8505546
(6S)-2-[(3-fluorophenyl)sulfonylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 8505546) has the molecular formula C16H17FN2O3S2 and a molecular weight of 368.46 g/mol. Its IUPAC name is (6S)-2-[(3-fluorophenyl)sulfonylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-[(3-fluorophenyl)sulfonylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 8505546 |
| Molecular Formula | C16H17FN2O3S2 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (6S)-2-[(3-fluorophenyl)sulfonylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@H]1CCc2c(sc(NS(=O)(=O)c3cccc(F)c3)c2C(N)=O)C1 |
| InChI | InChI=1S/C16H17FN2O3S2/c1-9-5-6-12-13(7-9)23-16(14(12)15(18)20)19-24(21,22)11-4-2-3-10(17)8-11/h2-4,8-9,19H,5-7H2,1H3,(H2,18,20)/t9-/m0/s1 |
| InChIKey | IYTJXSWWEVMOCV-VIFPVBQESA-N |
| XLogP | 2.91 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'} |
|---|