C15H12ClF3N2O3S2 — CID 2109514
2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 2109514) has the molecular formula C15H12ClF3N2O3S2 and a molecular weight of 424.85 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2109514 |
| Molecular Formula | C15H12ClF3N2O3S2 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)sc2c1CCC2 |
| InChI | InChI=1S/C15H12ClF3N2O3S2/c16-10-5-4-7(6-9(10)15(17,18)19)26(23,24)21-14-12(13(20)22)8-2-1-3-11(8)25-14/h4-6,21H,1-3H2,(H2,20,22) |
| InChIKey | DSNPEWAXEHDXIT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'} |
|---|