C10H14N2O3S2 — CID 35274190
2-(methanesulfonamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 35274190) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-(methanesulfonamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(methanesulfonamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 35274190 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-(methanesulfonamido)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C10H14N2O3S2/c1-17(14,15)12-10-8(9(11)13)6-4-2-3-5-7(6)16-10/h12H,2-5H2,1H3,(H2,11,13) |
| InChIKey | IMPLFSGQMAWBPY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_F(1)', 'substructure': 'N/A'} |
|---|