C13H21N3OS — CID 16640355
2-[2-(ethylamino)ethylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 16640355) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-[2-(ethylamino)ethylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[2-(ethylamino)ethylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 16640355 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-[2-(ethylamino)ethylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCNCCNc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C13H21N3OS/c1-2-15-7-8-16-13-11(12(14)17)9-5-3-4-6-10(9)18-13/h15-16H,2-8H2,1H3,(H2,14,17) |
| InChIKey | GPMLFSKJGQBYFY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|