C23H28N4O4S2 — CID 4123677
N,N'-bis(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pentanediamide (PubChem CID 4123677) has the molecular formula C23H28N4O4S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is N,N'-bis(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pentanediamide.
| Compound Name | N,N'-bis(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pentanediamide |
|---|---|
| PubChem CID | 4123677 |
| Molecular Formula | C23H28N4O4S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | N,N'-bis(3-carbamoyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)pentanediamide |
| SMILES | NC(=O)c1c(NC(=O)CCCC(=O)Nc2sc3c(c2C(N)=O)CCCC3)sc2c1CCCC2 |
| InChI | InChI=1S/C23H28N4O4S2/c24-20(30)18-12-6-1-3-8-14(12)32-22(18)26-16(28)10-5-11-17(29)27-23-19(21(25)31)13-7-2-4-9-15(13)33-23/h1-11H2,(H2,24,30)(H2,25,31)(H,26,28)(H,27,29) |
| InChIKey | GVAYLXJTEJJISB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |