C21H26N2O3S2 — CID 41086460
2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide (PubChem CID 41086460) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide.
| Compound Name | 2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 41086460 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)sulfanylbutanoylamino]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-3-carboxamide |
| SMILES | COc1ccc(SCCCC(=O)Nc2sc3c(c2C(N)=O)CCCCC3)cc1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-26-14-9-11-15(12-10-14)27-13-5-8-18(24)23-21-19(20(22)25)16-6-3-2-4-7-17(16)28-21/h9-12H,2-8,13H2,1H3,(H2,22,25)(H,23,24) |
| InChIKey | QRSRSUGFZPQHNE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|