C21H28N2OS — CID 1325519
(6S)-2-amino-6-tert-butyl-N-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 1325519) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is (6S)-2-amino-6-tert-butyl-N-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-amino-6-tert-butyl-N-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 1325519 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (6S)-2-amino-6-tert-butyl-N-(2,4-dimethylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(N)sc3c2CC[C@H](C(C)(C)C)C3)c(C)c1 |
| InChI | InChI=1S/C21H28N2OS/c1-12-6-9-16(13(2)10-12)23-20(24)18-15-8-7-14(21(3,4)5)11-17(15)25-19(18)22/h6,9-10,14H,7-8,11,22H2,1-5H3,(H,23,24)/t14-/m0/s1 |
| InChIKey | UPERXELYQDPAPF-AWEZNQCLSA-N |
| XLogP | 5.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|