C29H41N3O2S — CID 26875296
(6S)-6-tert-butyl-N-(2,4-dimethylphenyl)-2-[[2-[(3R)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 26875296) has the molecular formula C29H41N3O2S and a molecular weight of 495.73 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(2,4-dimethylphenyl)-2-[[2-[(3R)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(2,4-dimethylphenyl)-2-[[2-[(3R)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 26875296 |
| Molecular Formula | C29H41N3O2S |
| Molecular Weight | 495.73 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | (6S)-6-tert-butyl-N-(2,4-dimethylphenyl)-2-[[2-[(3R)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(NC(=O)CN3CCC[C@@H](C)C3)sc3c2CC[C@H](C(C)(C)C)C3)c(C)c1 |
| InChI | InChI=1S/C29H41N3O2S/c1-18-9-12-23(20(3)14-18)30-27(34)26-22-11-10-21(29(4,5)6)15-24(22)35-28(26)31-25(33)17-32-13-7-8-19(2)16-32/h9,12,14,19,21H,7-8,10-11,13,15-17H2,1-6H3,(H,30,34)(H,31,33)/t19-,21+/m1/s1 |
| InChIKey | AJQGTBLRFBMPQT-CTNGQTDRSA-N |
| XLogP | 6.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.73 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |