C29H41N3O4S — CID 51681413
(6R)-6-tert-butyl-N-(2,5-dimethoxyphenyl)-2-[[2-[(3S)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 51681413) has the molecular formula C29H41N3O4S and a molecular weight of 527.73 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(2,5-dimethoxyphenyl)-2-[[2-[(3S)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(2,5-dimethoxyphenyl)-2-[[2-[(3S)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 51681413 |
| Molecular Formula | C29H41N3O4S |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | (6R)-6-tert-butyl-N-(2,5-dimethoxyphenyl)-2-[[2-[(3S)-3-methylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2c(NC(=O)CN3CCC[C@H](C)C3)sc3c2CC[C@@H](C(C)(C)C)C3)c1 |
| InChI | InChI=1S/C29H41N3O4S/c1-18-8-7-13-32(16-18)17-25(33)31-28-26(21-11-9-19(29(2,3)4)14-24(21)37-28)27(34)30-22-15-20(35-5)10-12-23(22)36-6/h10,12,15,18-19H,7-9,11,13-14,16-17H2,1-6H3,(H,30,34)(H,31,33)/t18-,19+/m0/s1 |
| InChIKey | ULFXFPKJEHXNGN-RBUKOAKNSA-N |
| XLogP | 5.84 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |