C30H43N3O4S — CID 51673225
(6R)-6-tert-butyl-N-(2,4-dimethoxyphenyl)-2-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 51673225) has the molecular formula C30H43N3O4S and a molecular weight of 541.76 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(2,4-dimethoxyphenyl)-2-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(2,4-dimethoxyphenyl)-2-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 51673225 |
| Molecular Formula | C30H43N3O4S |
| Molecular Weight | 541.76 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | (6R)-6-tert-butyl-N-(2,4-dimethoxyphenyl)-2-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC[C@H]1CCCCN1CC(=O)Nc1sc2c(c1C(=O)Nc1ccc(OC)cc1OC)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C30H43N3O4S/c1-7-20-10-8-9-15-33(20)18-26(34)32-29-27(22-13-11-19(30(2,3)4)16-25(22)38-29)28(35)31-23-14-12-21(36-5)17-24(23)37-6/h12,14,17,19-20H,7-11,13,15-16,18H2,1-6H3,(H,31,35)(H,32,34)/t19-,20+/m1/s1 |
| InChIKey | IWNNHZUAWFVNEH-UXHICEINSA-N |
| XLogP | 6.37 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.76 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |