C16H16ClNO4S2 — CID 10110646
[2-amino-3-(4-chlorobenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] methanesulfonate (PubChem CID 10110646) has the molecular formula C16H16ClNO4S2 and a molecular weight of 385.89 g/mol. Its IUPAC name is [2-amino-3-(4-chlorobenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] methanesulfonate.
| Compound Name | [2-amino-3-(4-chlorobenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 10110646 |
| Molecular Formula | C16H16ClNO4S2 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | [2-amino-3-(4-chlorobenzoyl)-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCc2c(sc(N)c2C(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H16ClNO4S2/c1-24(20,21)22-11-6-7-12-13(8-11)23-16(18)14(12)15(19)9-2-4-10(17)5-3-9/h2-5,11H,6-8,18H2,1H3 |
| InChIKey | SZGLHSXCKPBUQC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|