C22H21ClN2OS — CID 18351235
[2-amino-6-(2-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-(4-chlorophenyl)methanone (PubChem CID 18351235) has the molecular formula C22H21ClN2OS and a molecular weight of 396.94 g/mol. Its IUPAC name is [2-amino-6-(2-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-(4-chlorophenyl)methanone.
| Compound Name | [2-amino-6-(2-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 18351235 |
| Molecular Formula | C22H21ClN2OS |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [2-amino-6-(2-phenylethyl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl]-(4-chlorophenyl)methanone |
| SMILES | Nc1sc2c(c1C(=O)c1ccc(Cl)cc1)CCN(CCc1ccccc1)C2 |
| InChI | InChI=1S/C22H21ClN2OS/c23-17-8-6-16(7-9-17)21(26)20-18-11-13-25(14-19(18)27-22(20)24)12-10-15-4-2-1-3-5-15/h1-9H,10-14,24H2 |
| InChIKey | VMIQRWAFDLFQEJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|