C21H20ClN2OS+ — CID 7194853
(2-amino-6-benzyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-yl)-(4-chlorophenyl)methanone (PubChem CID 7194853) has the molecular formula C21H20ClN2OS+ and a molecular weight of 383.92 g/mol. Its IUPAC name is (2-amino-6-benzyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-yl)-(4-chlorophenyl)methanone.
| Compound Name | (2-amino-6-benzyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-yl)-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 7194853 |
| Molecular Formula | C21H20ClN2OS+ |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (2-amino-6-benzyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-yl)-(4-chlorophenyl)methanone |
| SMILES | Nc1sc2c(c1C(=O)c1ccc(Cl)cc1)CC[NH+](Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H19ClN2OS/c22-16-8-6-15(7-9-16)20(25)19-17-10-11-24(13-18(17)26-21(19)23)12-14-4-2-1-3-5-14/h1-9H,10-13,23H2/p+1 |
| InChIKey | LUEXTQZEWNFRIZ-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|