C18H23N2O2S+ — CID 3456646
ethyl 2-amino-6-(2-phenylethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 3456646) has the molecular formula C18H23N2O2S+ and a molecular weight of 331.46 g/mol. Its IUPAC name is ethyl 2-amino-6-(2-phenylethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | ethyl 2-amino-6-(2-phenylethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 3456646 |
| Molecular Formula | C18H23N2O2S+ |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | ethyl 2-amino-6-(2-phenylethyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CC[NH+](CCc1ccccc1)C2 |
| InChI | InChI=1S/C18H22N2O2S/c1-2-22-18(21)16-14-9-11-20(12-15(14)23-17(16)19)10-8-13-6-4-3-5-7-13/h3-7H,2,8-12,19H2,1H3/p+1 |
| InChIKey | YIAPVCLCADJYMX-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|