C11H13F2NO2S — CID 71530536
ethyl 2-amino-6,6-difluoro-5,7-dihydro-4H-1-benzothiophene-3-carboxylate (PubChem CID 71530536) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is ethyl 2-amino-6,6-difluoro-5,7-dihydro-4H-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-amino-6,6-difluoro-5,7-dihydro-4H-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 71530536 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl 2-amino-6,6-difluoro-5,7-dihydro-4H-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CCC(F)(F)C2 |
| InChI | InChI=1S/C11H13F2NO2S/c1-2-16-10(15)8-6-3-4-11(12,13)5-7(6)17-9(8)14/h2-5,14H2,1H3 |
| InChIKey | OAPFDMNLLUFQEK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|