C12H16N2O3S — CID 68775827
ethyl 2-amino-5,5-dimethyl-7-oxo-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 68775827) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is ethyl 2-amino-5,5-dimethyl-7-oxo-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-amino-5,5-dimethyl-7-oxo-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 68775827 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 2-amino-5,5-dimethyl-7-oxo-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CC(C)(C)NC2=O |
| InChI | InChI=1S/C12H16N2O3S/c1-4-17-11(16)7-6-5-12(2,3)14-10(15)8(6)18-9(7)13/h4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | IMHZXPVTXCPBME-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|