C18H16N2O2S3 — CID 156579975
ethyl 7-amino-3-phenyl-2-sulfanylidene-4,5-dihydrothieno[3,2-g][1,3]benzothiazole-6-carboxylate (PubChem CID 156579975) has the molecular formula C18H16N2O2S3 and a molecular weight of 388.54 g/mol. Its IUPAC name is ethyl 7-amino-3-phenyl-2-sulfanylidene-4,5-dihydrothieno[3,2-g][1,3]benzothiazole-6-carboxylate.
| Compound Name | ethyl 7-amino-3-phenyl-2-sulfanylidene-4,5-dihydrothieno[3,2-g][1,3]benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 156579975 |
| Molecular Formula | C18H16N2O2S3 |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | ethyl 7-amino-3-phenyl-2-sulfanylidene-4,5-dihydrothieno[3,2-g][1,3]benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CCc1c-2sc(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2S3/c1-2-22-17(21)13-11-8-9-12-15(14(11)24-16(13)19)25-18(23)20(12)10-6-4-3-5-7-10/h3-7H,2,8-9,19H2,1H3 |
| InChIKey | JOHJOXPNKCWZEP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|