About ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate
ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 22464681) has the molecular formula C20H24N2O3S
and a molecular weight of 372.49 g/mol. Its IUPAC name is ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| PubChem CID | 22464681 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CCN(CCCC(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C20H24N2O3S/c1-2-25-20(24)18-15-10-12-22(13-17(15)26-19(18)21)11-6-9-16(23)14-7-4-3-5-8-14/h3-5,7-8H,2,6,9-13,21H2,1H3 |
| InChIKey | QJMVJXYYQXQIMP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The IUPAC name of ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (CID 22464681) is ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The canonical SMILES for ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate is CCOC(=O)c1c(N)sc2c1CCN(CCCC(=O)c1ccccc1)C2.
What is the InChIKey of ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
The InChIKey is QJMVJXYYQXQIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3S/c1-2-25-20(24)18-15-10-12-22(13-17(15)26-19(18)21)11-6-9-16(23)14-7-4-3-5-8-14/h3-5,7-8H,2,6,9-13,21H2,1H3.
What are the key properties of ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate?
ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate has a molecular weight of 372.49 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-6-(4-oxo-4-phenylbutyl)-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate is sourced from PubChem (CID 22464681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).