C14H20N2O4S — CID 13072081
diethyl 2-amino-4,5,7,8-tetrahydrothieno[2,3-d]azepine-3,6-dicarboxylate (PubChem CID 13072081) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is diethyl 2-amino-4,5,7,8-tetrahydrothieno[2,3-d]azepine-3,6-dicarboxylate.
| Compound Name | diethyl 2-amino-4,5,7,8-tetrahydrothieno[2,3-d]azepine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 13072081 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | diethyl 2-amino-4,5,7,8-tetrahydrothieno[2,3-d]azepine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(N)sc2c1CCN(C(=O)OCC)CC2 |
| InChI | InChI=1S/C14H20N2O4S/c1-3-19-13(17)11-9-5-7-16(14(18)20-4-2)8-6-10(9)21-12(11)15/h3-8,15H2,1-2H3 |
| InChIKey | REEDFQWPKWVSQT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|