C19H15N3O2S2 — CID 135005037
ethyl 3-phenyl-4-(phenyliminomethylideneamino)-2-sulfanylidene-1,3-thiazole-5-carboxylate (PubChem CID 135005037) has the molecular formula C19H15N3O2S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is ethyl 3-phenyl-4-(phenyliminomethylideneamino)-2-sulfanylidene-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 3-phenyl-4-(phenyliminomethylideneamino)-2-sulfanylidene-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 135005037 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | ethyl 3-phenyl-4-(phenyliminomethylideneamino)-2-sulfanylidene-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(=S)n(-c2ccccc2)c1N=C=Nc1ccccc1 |
| InChI | InChI=1S/C19H15N3O2S2/c1-2-24-18(23)16-17(21-13-20-14-9-5-3-6-10-14)22(19(25)26-16)15-11-7-4-8-12-15/h3-12H,2H2,1H3 |
| InChIKey | VTCLQCVIPLOJRF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|