C22H16N4O3S3 — CID 3598840
ethyl 4-[5-(cyanomethylsulfanyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]benzoate (PubChem CID 3598840) has the molecular formula C22H16N4O3S3 and a molecular weight of 480.60 g/mol. Its IUPAC name is ethyl 4-[5-(cyanomethylsulfanyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]benzoate.
| Compound Name | ethyl 4-[5-(cyanomethylsulfanyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]benzoate |
|---|---|
| PubChem CID | 3598840 |
| Molecular Formula | C22H16N4O3S3 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | ethyl 4-[5-(cyanomethylsulfanyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(=S)sc3c(=O)n(-c4ccccc4)c(SCC#N)nc32)cc1 |
| InChI | InChI=1S/C22H16N4O3S3/c1-2-29-20(28)14-8-10-16(11-9-14)25-18-17(32-22(25)30)19(27)26(15-6-4-3-5-7-15)21(24-18)31-13-12-23/h3-11H,2,13H2,1H3 |
| InChIKey | USSYRUIZWFPXTL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|