C27H20FN3O3S3 — CID 3552858
3-(2-ethoxyphenyl)-6-(4-fluorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 3552858) has the molecular formula C27H20FN3O3S3 and a molecular weight of 549.67 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-6-(4-fluorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-(2-ethoxyphenyl)-6-(4-fluorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 3552858 |
| Molecular Formula | C27H20FN3O3S3 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 3-(2-ethoxyphenyl)-6-(4-fluorophenyl)-5-phenacylsulfanyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCOc1ccccc1-n1c(=S)sc2c(=O)n(-c3ccc(F)cc3)c(SCC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C27H20FN3O3S3/c1-2-34-22-11-7-6-10-20(22)31-24-23(37-27(31)35)25(33)30(19-14-12-18(28)13-15-19)26(29-24)36-16-21(32)17-8-4-3-5-9-17/h3-15H,2,16H2,1H3 |
| InChIKey | BNFUYSRDAJQXKQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|