C24H21N3O4S3 — CID 3437140
ethyl 4-[[3-(2-methylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-3-oxobutanoate (PubChem CID 3437140) has the molecular formula C24H21N3O4S3 and a molecular weight of 511.65 g/mol. Its IUPAC name is ethyl 4-[[3-(2-methylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 4-[[3-(2-methylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 3437140 |
| Molecular Formula | C24H21N3O4S3 |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | ethyl 4-[[3-(2-methylphenyl)-7-oxo-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-5-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nc2c(sc(=S)n2-c2ccccc2C)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4S3/c1-3-31-19(29)13-17(28)14-33-23-25-21-20(22(30)26(23)16-10-5-4-6-11-16)34-24(32)27(21)18-12-8-7-9-15(18)2/h4-12H,3,13-14H2,1-2H3 |
| InChIKey | IWELUEGIXWUCFB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|