C26H19N3O2S3 — CID 3308487
3-(2-methylphenyl)-5-phenacylsulfanyl-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 3308487) has the molecular formula C26H19N3O2S3 and a molecular weight of 501.66 g/mol. Its IUPAC name is 3-(2-methylphenyl)-5-phenacylsulfanyl-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-(2-methylphenyl)-5-phenacylsulfanyl-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 3308487 |
| Molecular Formula | C26H19N3O2S3 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 3-(2-methylphenyl)-5-phenacylsulfanyl-6-phenyl-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1ccccc1-n1c(=S)sc2c(=O)n(-c3ccccc3)c(SCC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C26H19N3O2S3/c1-17-10-8-9-15-20(17)29-23-22(34-26(29)32)24(31)28(19-13-6-3-7-14-19)25(27-23)33-16-21(30)18-11-4-2-5-12-18/h2-15H,16H2,1H3 |
| InChIKey | UXAGSYOWELKNSR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|