C21H17N3O3S3 — CID 135446495
3-(2-ethoxyphenyl)-5-phenacylsulfanyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 135446495) has the molecular formula C21H17N3O3S3 and a molecular weight of 455.59 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-5-phenacylsulfanyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-(2-ethoxyphenyl)-5-phenacylsulfanyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135446495 |
| Molecular Formula | C21H17N3O3S3 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 3-(2-ethoxyphenyl)-5-phenacylsulfanyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCOc1ccccc1-n1c(=S)sc2c(=O)[nH]c(SCC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C21H17N3O3S3/c1-2-27-16-11-7-6-10-14(16)24-18-17(30-21(24)28)19(26)23-20(22-18)29-12-15(25)13-8-4-3-5-9-13/h3-11H,2,12H2,1H3,(H,22,23,26) |
| InChIKey | YPHUHZURUBFCES-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|