C17H18N4O2S3 — CID 135468402
N,N-diethyl-2-[(7-oxo-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide (PubChem CID 135468402) has the molecular formula C17H18N4O2S3 and a molecular weight of 406.56 g/mol. Its IUPAC name is N,N-diethyl-2-[(7-oxo-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide.
| Compound Name | N,N-diethyl-2-[(7-oxo-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135468402 |
| Molecular Formula | C17H18N4O2S3 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | N,N-diethyl-2-[(7-oxo-3-phenyl-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidin-5-yl)sulfanyl]acetamide |
| SMILES | CCN(CC)C(=O)CSc1nc2c(sc(=S)n2-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H18N4O2S3/c1-3-20(4-2)12(22)10-25-16-18-14-13(15(23)19-16)26-17(24)21(14)11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H,18,19,23) |
| InChIKey | BQFJACSDDVDQEW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|